C15H18N6O4 — CID 173185304
azane;hydroxyimino-oxido-[[4-[2-oxo-2-[2-(pyridin-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]methyl]azanium (PubChem CID 173185304) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is azane;hydroxyimino-oxido-[[4-[2-oxo-2-[2-(pyridin-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]methyl]azanium.
| Compound Name | azane;hydroxyimino-oxido-[[4-[2-oxo-2-[2-(pyridin-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 173185304 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | azane;hydroxyimino-oxido-[[4-[2-oxo-2-[2-(pyridin-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]methyl]azanium |
| SMILES | N.O=C(COc1ccc(C[N+]([O-])=NO)cc1)NN=Cc1cccnc1 |
| InChI | InChI=1S/C15H15N5O4.H3N/c21-15(18-17-9-13-2-1-7-16-8-13)11-24-14-5-3-12(4-6-14)10-20(23)19-22;/h1-9,22H,10-11H2,(H,18,21);1H3 |
| InChIKey | LVPXTQXBCIHKAC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|