C16H16N4O4 — CID 173185126
[4-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenyl]methyl-hydroxyimino-oxidoazanium (PubChem CID 173185126) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is [4-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenyl]methyl-hydroxyimino-oxidoazanium.
| Compound Name | [4-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenyl]methyl-hydroxyimino-oxidoazanium |
|---|---|
| PubChem CID | 173185126 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [4-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenyl]methyl-hydroxyimino-oxidoazanium |
| SMILES | O=C(COc1ccc(C[N+]([O-])=NO)cc1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C16H16N4O4/c21-16(18-17-10-13-4-2-1-3-5-13)12-24-15-8-6-14(7-9-15)11-20(23)19-22/h1-10,22H,11-12H2,(H,18,21)/b17-10+,20-19? |
| InChIKey | IYDWXHUFNDELPS-OVZIBMEBSA-N |
| XLogP | 2.07 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|