C38H43N5O6 — CID 173185663
[3-[3-[ethyl-[(4-hydroxy-3-methoxyphenyl)methylamino]carbamoyl]anilino]-3-oxopropyl] N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate (PubChem CID 173185663) has the molecular formula C38H43N5O6 and a molecular weight of 665.79 g/mol. Its IUPAC name is [3-[3-[ethyl-[(4-hydroxy-3-methoxyphenyl)methylamino]carbamoyl]anilino]-3-oxopropyl] N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate.
| Compound Name | [3-[3-[ethyl-[(4-hydroxy-3-methoxyphenyl)methylamino]carbamoyl]anilino]-3-oxopropyl] N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
|---|---|
| PubChem CID | 173185663 |
| Molecular Formula | C38H43N5O6 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | [3-[3-[ethyl-[(4-hydroxy-3-methoxyphenyl)methylamino]carbamoyl]anilino]-3-oxopropyl] N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
| SMILES | CCN(NCc1ccc(O)c(OC)c1)C(=O)c1cccc(NC(=O)CCOC(=O)N(c2ccccc2-c2ccccc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C38H43N5O6/c1-3-42(39-27-28-19-20-34(44)35(25-28)48-2)37(46)30-15-12-16-31(26-30)40-36(45)21-24-49-38(47)43(41-22-10-5-11-23-41)33-18-9-8-17-32(33)29-13-6-4-7-14-29/h4,6-9,12-20,25-26,39,44H,3,5,10-11,21-24,27H2,1-2H3,(H,40,45) |
| InChIKey | AQOJRPMCDGEFNV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|