C17H30N2O6 — CID 173188802
tert-butyl 6-[methoxy(methyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohex-5-enoate (PubChem CID 173188802) has the molecular formula C17H30N2O6 and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl 6-[methoxy(methyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohex-5-enoate.
| Compound Name | tert-butyl 6-[methoxy(methyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 173188802 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl 6-[methoxy(methyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohex-5-enoate |
| SMILES | CON(C)C=CC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O6/c1-16(2,3)24-14(21)13(18-15(22)25-17(4,5)6)11-12(20)9-10-19(7)23-8/h9-10,13H,11H2,1-8H3,(H,18,22) |
| InChIKey | OHDHMQHHHIZTQM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|