C20H32N2O6 — CID 10834561
tert-butyl (2S,5E,7Z)-7-acetyl-8-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxonona-5,7-dienoate (PubChem CID 10834561) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl (2S,5E,7Z)-7-acetyl-8-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxonona-5,7-dienoate.
| Compound Name | tert-butyl (2S,5E,7Z)-7-acetyl-8-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxonona-5,7-dienoate |
|---|---|
| PubChem CID | 10834561 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | tert-butyl (2S,5E,7Z)-7-acetyl-8-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxonona-5,7-dienoate |
| SMILES | CC(=O)C(/C=C/C(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=C(/C)N |
| InChI | InChI=1S/C20H32N2O6/c1-12(21)15(13(2)23)10-9-14(24)11-16(17(25)27-19(3,4)5)22-18(26)28-20(6,7)8/h9-10,16H,11,21H2,1-8H3,(H,22,26)/b10-9+,15-12-/t16-/m0/s1 |
| InChIKey | CORMQPHXDAYVGG-JVMLZAFNSA-N |
| XLogP | 2.56 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|