C11H21N3O3 — CID 89390053
tert-butyl N-[(Z,3R)-5,6-diamino-2-oxohex-5-en-3-yl]carbamate (PubChem CID 89390053) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is tert-butyl N-[(Z,3R)-5,6-diamino-2-oxohex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,3R)-5,6-diamino-2-oxohex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 89390053 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | tert-butyl N-[(Z,3R)-5,6-diamino-2-oxohex-5-en-3-yl]carbamate |
| SMILES | CC(=O)[C@@H](C/C(N)=C/N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21N3O3/c1-7(15)9(5-8(13)6-12)14-10(16)17-11(2,3)4/h6,9H,5,12-13H2,1-4H3,(H,14,16)/b8-6-/t9-/m1/s1 |
| InChIKey | GJGHLUYOIULKEC-JGAIRUGNSA-N |
| XLogP | 0.62 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |