C27H37NO2 — CID 173188953
(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid;quinoline (PubChem CID 173188953) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid;quinoline.
| Compound Name | (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid;quinoline |
|---|---|
| PubChem CID | 173188953 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid;quinoline |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H30O2.C9H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-6-9-8(4-1)5-3-7-10-9/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20);1-7H/b4-3-,7-6-,10-9-; |
| InChIKey | PJEJSAHNCWDIFM-IFNWOZJISA-N |
| XLogP | 7.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|