C17H31N4+ — CID 173190763
1-dodecyl-6,7-dihydro-3H-purin-1-ium (PubChem CID 173190763) has the molecular formula C17H31N4+ and a molecular weight of 291.46 g/mol. Its IUPAC name is 1-dodecyl-6,7-dihydro-3H-purin-1-ium.
| Compound Name | 1-dodecyl-6,7-dihydro-3H-purin-1-ium |
|---|---|
| PubChem CID | 173190763 |
| Molecular Formula | C17H31N4+ |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.25 |
| IUPAC Name | 1-dodecyl-6,7-dihydro-3H-purin-1-ium |
| SMILES | CCCCCCCCCCCC[N+]1=CNc2nc[nH]c2C1 |
| InChI | InChI=1S/C17H30N4/c1-2-3-4-5-6-7-8-9-10-11-12-21-13-16-17(20-15-21)19-14-18-16/h14-15H,2-13H2,1H3,(H,18,19)/p+1 |
| InChIKey | IBNXRMFFMWHFFF-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 43.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|