C31H40INO2 — CID 173190836
2-[3-[2-(3-iodophenyl)-2,6-dimethylheptan-3-yl]phenoxy]-N-[(2-methoxyphenyl)methyl]ethanamine (PubChem CID 173190836) has the molecular formula C31H40INO2 and a molecular weight of 585.57 g/mol. Its IUPAC name is 2-[3-[2-(3-iodophenyl)-2,6-dimethylheptan-3-yl]phenoxy]-N-[(2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[3-[2-(3-iodophenyl)-2,6-dimethylheptan-3-yl]phenoxy]-N-[(2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 173190836 |
| Molecular Formula | C31H40INO2 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-[3-[2-(3-iodophenyl)-2,6-dimethylheptan-3-yl]phenoxy]-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccccc1CNCCOc1cccc(C(CCC(C)C)C(C)(C)c2cccc(I)c2)c1 |
| InChI | InChI=1S/C31H40INO2/c1-23(2)16-17-29(31(3,4)26-12-9-13-27(32)21-26)24-11-8-14-28(20-24)35-19-18-33-22-25-10-6-7-15-30(25)34-5/h6-15,20-21,23,29,33H,16-19,22H2,1-5H3 |
| InChIKey | IKOGWLHERKCRNI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|