About 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid
1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid (PubChem CID 173191697) has the molecular formula C9H29ClF6N2O18P6
and a molecular weight of 788.61 g/mol. Its IUPAC name is 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid.
Molecular Properties
| Compound Name | 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid |
| PubChem CID | 173191697 |
| Molecular Formula | C9H29ClF6N2O18P6 |
| Molecular Weight | 788.61 g/mol |
| Exact Mass | 787.94 |
| IUPAC Name | 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid |
| SMILES | ClC(N1CCCC1)N1CCCC1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F |
| InChI | InChI=1S/C9H17ClN2.6FH2O3P/c10-9(11-5-1-2-6-11)12-7-3-4-8-12;6*1-5(2,3)4/h9H,1-8H2;6*(H2,2,3,4) |
| InChIKey | USVNTFLATDZXCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 351.66 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 788.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid?
The IUPAC name of 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid (CID 173191697) is 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid.
What is the SMILES notation for 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid?
The canonical SMILES for 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid is ClC(N1CCCC1)N1CCCC1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.
What is the InChIKey of 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid?
The InChIKey is USVNTFLATDZXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClN2.6FH2O3P/c10-9(11-5-1-2-6-11)12-7-3-4-8-12;6*1-5(2,3)4/h9H,1-8H2;6*(H2,2,3,4).
What are the key properties of 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid?
1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid has a molecular weight of 788.61 g/mol, XLogP of 1.99, 2 rotatable bonds, 12 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[chloro(pyrrolidin-1-yl)methyl]pyrrolidine;fluorophosphonic acid is sourced from PubChem (CID 173191697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).