C14H14N2O3 — CID 173193026
2-[4-(1,3-oxazol-2-yl)-4-oxobutyl]benzamide (PubChem CID 173193026) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-[4-(1,3-oxazol-2-yl)-4-oxobutyl]benzamide.
| Compound Name | 2-[4-(1,3-oxazol-2-yl)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 173193026 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[4-(1,3-oxazol-2-yl)-4-oxobutyl]benzamide |
| SMILES | NC(=O)c1ccccc1CCCC(=O)c1ncco1 |
| InChI | InChI=1S/C14H14N2O3/c15-13(18)11-6-2-1-4-10(11)5-3-7-12(17)14-16-8-9-19-14/h1-2,4,6,8-9H,3,5,7H2,(H2,15,18) |
| InChIKey | UAUJAXNNJZSSJX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |