C12H20N2O3 — CID 173195859
4-(aminomethyl)-3-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]benzene-1,2-diol (PubChem CID 173195859) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-(aminomethyl)-3-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]benzene-1,2-diol.
| Compound Name | 4-(aminomethyl)-3-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]benzene-1,2-diol |
|---|---|
| PubChem CID | 173195859 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-(aminomethyl)-3-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]benzene-1,2-diol |
| SMILES | CC(C)[C@H](CO)Nc1c(CN)ccc(O)c1O |
| InChI | InChI=1S/C12H20N2O3/c1-7(2)9(6-15)14-11-8(5-13)3-4-10(16)12(11)17/h3-4,7,9,14-17H,5-6,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | KGLGNQXNGPIOTM-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|