C20H22N6O3 — CID 173196502
(2S)-2-ethoxy-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-phenyl-1,2,4-triazol-3-yl)acetamide (PubChem CID 173196502) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is (2S)-2-ethoxy-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-phenyl-1,2,4-triazol-3-yl)acetamide.
| Compound Name | (2S)-2-ethoxy-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-phenyl-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 173196502 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2S)-2-ethoxy-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-phenyl-1,2,4-triazol-3-yl)acetamide |
| SMILES | CCO[C@H](C(=O)NCc1ccc(C(N)=NO)cc1)C1(c2ccccc2)N=CN=N1 |
| InChI | InChI=1S/C20H22N6O3/c1-2-29-17(20(23-13-24-26-20)16-6-4-3-5-7-16)19(27)22-12-14-8-10-15(11-9-14)18(21)25-28/h3-11,13,17,28H,2,12H2,1H3,(H2,21,25)(H,22,27)/t17-,20?/m1/s1 |
| InChIKey | KPAKMVAKIDKWOP-DIAVIDTQSA-N |
| XLogP | 2.15 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|