C19H17ClO — CID 173197359
1-chloro-4-[2-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]benzene (PubChem CID 173197359) has the molecular formula C19H17ClO and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-chloro-4-[2-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]benzene.
| Compound Name | 1-chloro-4-[2-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]benzene |
|---|---|
| PubChem CID | 173197359 |
| Molecular Formula | C19H17ClO |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-chloro-4-[2-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]benzene |
| SMILES | COc1ccc(C2=C(c3ccc(Cl)cc3)C=CCC2)cc1 |
| InChI | InChI=1S/C19H17ClO/c1-21-17-12-8-15(9-13-17)19-5-3-2-4-18(19)14-6-10-16(20)11-7-14/h2,4,6-13H,3,5H2,1H3 |
| InChIKey | OUBZQGGTIXTDPS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|