C19H37KN4O4S2 — CID 173197580
potassium;1,1-dicyano-N,N'-bis(2-ethylhexyl)methanedisulfonamide;hydride (PubChem CID 173197580) has the molecular formula C19H37KN4O4S2 and a molecular weight of 488.76 g/mol. Its IUPAC name is potassium;1,1-dicyano-N,N'-bis(2-ethylhexyl)methanedisulfonamide;hydride.
| Compound Name | potassium;1,1-dicyano-N,N'-bis(2-ethylhexyl)methanedisulfonamide;hydride |
|---|---|
| PubChem CID | 173197580 |
| Molecular Formula | C19H37KN4O4S2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | potassium;1,1-dicyano-N,N'-bis(2-ethylhexyl)methanedisulfonamide;hydride |
| SMILES | CCCCC(CC)CNS(=O)(=O)C(C#N)(C#N)S(=O)(=O)NCC(CC)CCCC.[H-].[K+] |
| InChI | InChI=1S/C19H36N4O4S2.K.H/c1-5-9-11-17(7-3)13-22-28(24,25)19(15-20,16-21)29(26,27)23-14-18(8-4)12-10-6-2;;/h17-18,22-23H,5-14H2,1-4H3;;/q;+1;-1 |
| InChIKey | KEHRKMDYSFITGJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |