C16H13ClN2O2S — CID 173207420
5-(4-chlorophenyl)-1-(2-methylsulfonylphenyl)pyrazole (PubChem CID 173207420) has the molecular formula C16H13ClN2O2S and a molecular weight of 332.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2-methylsulfonylphenyl)pyrazole.
| Compound Name | 5-(4-chlorophenyl)-1-(2-methylsulfonylphenyl)pyrazole |
|---|---|
| PubChem CID | 173207420 |
| Molecular Formula | C16H13ClN2O2S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2-methylsulfonylphenyl)pyrazole |
| SMILES | CS(=O)(=O)c1ccccc1-n1nccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O2S/c1-22(20,21)16-5-3-2-4-15(16)19-14(10-11-18-19)12-6-8-13(17)9-7-12/h2-11H,1H3 |
| InChIKey | WXKCFJVYVYAVLE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |