C12H24OSi2 — CID 173207972
(3-cyclopenta-1,4-dien-1-yl-3-methyl-2-silyloxybutan-2-yl)-dimethylsilane (PubChem CID 173207972) has the molecular formula C12H24OSi2 and a molecular weight of 240.49 g/mol. Its IUPAC name is (3-cyclopenta-1,4-dien-1-yl-3-methyl-2-silyloxybutan-2-yl)-dimethylsilane.
| Compound Name | (3-cyclopenta-1,4-dien-1-yl-3-methyl-2-silyloxybutan-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 173207972 |
| Molecular Formula | C12H24OSi2 |
| Molecular Weight | 240.49 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3-cyclopenta-1,4-dien-1-yl-3-methyl-2-silyloxybutan-2-yl)-dimethylsilane |
| SMILES | C[SiH](C)C(C)(O[SiH3])C(C)(C)C1=CCC=C1 |
| InChI | InChI=1S/C12H24OSi2/c1-11(2,10-8-6-7-9-10)12(3,13-14)15(4)5/h6,8-9,15H,7H2,1-5,14H3 |
| InChIKey | OWRORWQNFDCVRZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|