C14H18O — CID 87993482
3,3-di(cyclopenta-1,4-dien-1-yl)butan-1-ol (PubChem CID 87993482) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 3,3-di(cyclopenta-1,4-dien-1-yl)butan-1-ol.
| Compound Name | 3,3-di(cyclopenta-1,4-dien-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 87993482 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3,3-di(cyclopenta-1,4-dien-1-yl)butan-1-ol |
| SMILES | CC(CCO)(C1=CCC=C1)C1=CCC=C1 |
| InChI | InChI=1S/C14H18O/c1-14(10-11-15,12-6-2-3-7-12)13-8-4-5-9-13/h2,4,6-9,15H,3,5,10-11H2,1H3 |
| InChIKey | MRYDHKAPVCBCMS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |