C13H18N4O — CID 173214158
(2R)-2,6-diamino-1-(1H-benzimidazol-2-yl)hexan-1-one (PubChem CID 173214158) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is (2R)-2,6-diamino-1-(1H-benzimidazol-2-yl)hexan-1-one.
| Compound Name | (2R)-2,6-diamino-1-(1H-benzimidazol-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 173214158 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R)-2,6-diamino-1-(1H-benzimidazol-2-yl)hexan-1-one |
| SMILES | NCCCC[C@@H](N)C(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H18N4O/c14-8-4-3-5-9(15)12(18)13-16-10-6-1-2-7-11(10)17-13/h1-2,6-7,9H,3-5,8,14-15H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | YIFGONKBRLAOPU-SECBINFHSA-N |
| XLogP | 1.20 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|