C18H22N4 — CID 91332325
5-(1H-benzimidazol-2-yl)-5-phenylpentane-1,4-diamine (PubChem CID 91332325) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yl)-5-phenylpentane-1,4-diamine.
| Compound Name | 5-(1H-benzimidazol-2-yl)-5-phenylpentane-1,4-diamine |
|---|---|
| PubChem CID | 91332325 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-(1H-benzimidazol-2-yl)-5-phenylpentane-1,4-diamine |
| SMILES | NCCCC(N)C(c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H22N4/c19-12-6-9-14(20)17(13-7-2-1-3-8-13)18-21-15-10-4-5-11-16(15)22-18/h1-5,7-8,10-11,14,17H,6,9,12,19-20H2,(H,21,22) |
| InChIKey | JHKXKEXYSHONHX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |