C14H16F2N4O3 — CID 173214222
5-(aminomethyl)-3-(3,3-difluoro-2-methoxyimino-1-methylindol-4-yl)-1,3-oxazolidin-2-one (PubChem CID 173214222) has the molecular formula C14H16F2N4O3 and a molecular weight of 326.30 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(3,3-difluoro-2-methoxyimino-1-methylindol-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-(3,3-difluoro-2-methoxyimino-1-methylindol-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 173214222 |
| Molecular Formula | C14H16F2N4O3 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-(aminomethyl)-3-(3,3-difluoro-2-methoxyimino-1-methylindol-4-yl)-1,3-oxazolidin-2-one |
| SMILES | CON=C1N(C)c2cccc(N3CC(CN)OC3=O)c2C1(F)F |
| InChI | InChI=1S/C14H16F2N4O3/c1-19-9-4-3-5-10(20-7-8(6-17)23-13(20)21)11(9)14(15,16)12(19)18-22-2/h3-5,8H,6-7,17H2,1-2H3 |
| InChIKey | CGNHXLSLGFIMIJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|