C14H17FN4O4 — CID 173215446
5-(aminomethyl)-3-(5-fluoro-3-methoxyimino-4-methyl-1,4-benzoxazin-7-yl)-1,3-oxazolidin-2-one (PubChem CID 173215446) has the molecular formula C14H17FN4O4 and a molecular weight of 324.31 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(5-fluoro-3-methoxyimino-4-methyl-1,4-benzoxazin-7-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-(5-fluoro-3-methoxyimino-4-methyl-1,4-benzoxazin-7-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 173215446 |
| Molecular Formula | C14H17FN4O4 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-(aminomethyl)-3-(5-fluoro-3-methoxyimino-4-methyl-1,4-benzoxazin-7-yl)-1,3-oxazolidin-2-one |
| SMILES | CON=C1COc2cc(N3CC(CN)OC3=O)cc(F)c2N1C |
| InChI | InChI=1S/C14H17FN4O4/c1-18-12(17-21-2)7-22-11-4-8(3-10(15)13(11)18)19-6-9(5-16)23-14(19)20/h3-4,9H,5-7,16H2,1-2H3 |
| InChIKey | TTWQRTQPSFAKBF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|