C15H16F2N4O5 — CID 87806508
[(5S)-3-[3,5-difluoro-4-(3-methoxyiminoazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid (PubChem CID 87806508) has the molecular formula C15H16F2N4O5 and a molecular weight of 370.31 g/mol. Its IUPAC name is [(5S)-3-[3,5-difluoro-4-(3-methoxyiminoazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid.
| Compound Name | [(5S)-3-[3,5-difluoro-4-(3-methoxyiminoazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 87806508 |
| Molecular Formula | C15H16F2N4O5 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(5S)-3-[3,5-difluoro-4-(3-methoxyiminoazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
| SMILES | CON=C1CN(c2c(F)cc(N3C[C@H](CNC(=O)O)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C15H16F2N4O5/c1-25-19-8-5-20(6-8)13-11(16)2-9(3-12(13)17)21-7-10(26-15(21)24)4-18-14(22)23/h2-3,10,18H,4-7H2,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | PGBUNUXPMWWMHD-JTQLQIEISA-N |
| XLogP | 1.38 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|