About CID 173214608
CID 173214608 (PubChem CID 173214608) has the molecular formula C4H11Cl2Sn
and a molecular weight of 248.75 g/mol.
Molecular Properties
| Compound Name | CID 173214608 |
| PubChem CID | 173214608 |
| Molecular Formula | C4H11Cl2Sn |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.93 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Sn].Cl.Cl |
| InChI | InChI=1S/C4H9.2ClH.Sn/c1-4(2)3;;;/h1-3H3;2*1H; |
| InChIKey | YWNJVLWMYCAOSD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173214608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173214608?
The IUPAC name of CID 173214608 (CID 173214608) is not available.
What is the SMILES notation for CID 173214608?
The canonical SMILES for CID 173214608 is CC(C)(C)[Sn].Cl.Cl.
What is the InChIKey of CID 173214608?
The InChIKey is YWNJVLWMYCAOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.2ClH.Sn/c1-4(2)3;;;/h1-3H3;2*1H;.
What are the key properties of CID 173214608?
CID 173214608 has a molecular weight of 248.75 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173214608 is sourced from PubChem (CID 173214608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).