C24H28N4O2S — CID 17321477
3-(2-ethylbutanoylamino)-N-[5-(3-phenylpropyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 17321477) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-(2-ethylbutanoylamino)-N-[5-(3-phenylpropyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-(2-ethylbutanoylamino)-N-[5-(3-phenylpropyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17321477 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-(2-ethylbutanoylamino)-N-[5-(3-phenylpropyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCC(CC)C(=O)Nc1cccc(C(=O)Nc2nnc(CCCc3ccccc3)s2)c1 |
| InChI | InChI=1S/C24H28N4O2S/c1-3-18(4-2)22(29)25-20-14-9-13-19(16-20)23(30)26-24-28-27-21(31-24)15-8-12-17-10-6-5-7-11-17/h5-7,9-11,13-14,16,18H,3-4,8,12,15H2,1-2H3,(H,25,29)(H,26,28,30) |
| InChIKey | GFZNRLUUHUGPPH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |