C37H74 — CID 173215859
3,7-diethylnon-1-ene;7-ethyldec-1-ene;2-methylundec-2-ene (PubChem CID 173215859) has the molecular formula C37H74 and a molecular weight of 519.00 g/mol. Its IUPAC name is 3,7-diethylnon-1-ene;7-ethyldec-1-ene;2-methylundec-2-ene.
| Compound Name | 3,7-diethylnon-1-ene;7-ethyldec-1-ene;2-methylundec-2-ene |
|---|---|
| PubChem CID | 173215859 |
| Molecular Formula | C37H74 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.58 |
| IUPAC Name | 3,7-diethylnon-1-ene;7-ethyldec-1-ene;2-methylundec-2-ene |
| SMILES | C=CC(CC)CCCC(CC)CC.C=CCCCCC(CC)CCC.CCCCCCCCC=C(C)C |
| InChI | InChI=1S/C13H26.2C12H24/c1-5-12(6-2)10-9-11-13(7-3)8-4;1-4-5-6-7-8-9-10-11-12(2)3;1-4-7-8-9-11-12(6-3)10-5-2/h5,12-13H,1,6-11H2,2-4H3;11H,4-10H2,1-3H3;4,12H,1,5-11H2,2-3H3 |
| InChIKey | KAHDNFHWTGMDPA-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|