C13H28N+ — CID 173215884
1-butyl-2,2,6,6-tetramethylpiperidin-1-ium (PubChem CID 173215884) has the molecular formula C13H28N+ and a molecular weight of 198.37 g/mol. Its IUPAC name is 1-butyl-2,2,6,6-tetramethylpiperidin-1-ium.
| Compound Name | 1-butyl-2,2,6,6-tetramethylpiperidin-1-ium |
|---|---|
| PubChem CID | 173215884 |
| Molecular Formula | C13H28N+ |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.22 |
| IUPAC Name | 1-butyl-2,2,6,6-tetramethylpiperidin-1-ium |
| SMILES | CCCC[NH+]1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C13H27N/c1-6-7-11-14-12(2,3)9-8-10-13(14,4)5/h6-11H2,1-5H3/p+1 |
| InChIKey | WRBGFIRROIPTIY-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |