C36H25B2F20N — CID 139124703
[(1S)-1-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-1-yl)propyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139124703) has the molecular formula C36H25B2F20N and a molecular weight of 873.19 g/mol. Its IUPAC name is [(1S)-1-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-1-yl)propyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(1S)-1-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-1-yl)propyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139124703 |
| Molecular Formula | C36H25B2F20N |
| Molecular Weight | 873.19 g/mol |
| Exact Mass | 873.19 |
| IUPAC Name | [(1S)-1-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-1-yl)propyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC1(C)CCCC(C)(C)[NH+]1CC[C@@H](B(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)[BH-](c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C36H24B2F20N/c1-35(2)7-5-8-36(3,4)59(35)9-6-10(37(11-15(39)23(47)31(55)24(48)16(11)40)12-17(41)25(49)32(56)26(50)18(12)42)38(13-19(43)27(51)33(57)28(52)20(13)44)14-21(45)29(53)34(58)30(54)22(14)46/h10,37H,5-9H2,1-4H3/q-1/p+1/t10-/m1/s1 |
| InChIKey | KJVNQQXRFAZVFF-SNVBAGLBSA-O |
| XLogP | 7.04 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.19 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|