C12H23F3N2 — CID 65283826
3-(4,4-dimethylazepan-1-yl)-4,4,4-trifluorobutan-1-amine (PubChem CID 65283826) has the molecular formula C12H23F3N2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 65283826 |
| Molecular Formula | C12H23F3N2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)-4,4,4-trifluorobutan-1-amine |
| SMILES | CC1(C)CCCN(C(CCN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N2/c1-11(2)5-3-8-17(9-6-11)10(4-7-16)12(13,14)15/h10H,3-9,16H2,1-2H3 |
| InChIKey | DOAGKWQQOQCPEN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |