C12H16NO6P — CID 173217685
(2R)-2-[(4-hydroxyphenyl)methyl]-2-(phosphonoamino)pent-4-enoic acid (PubChem CID 173217685) has the molecular formula C12H16NO6P and a molecular weight of 301.24 g/mol. Its IUPAC name is (2R)-2-[(4-hydroxyphenyl)methyl]-2-(phosphonoamino)pent-4-enoic acid.
| Compound Name | (2R)-2-[(4-hydroxyphenyl)methyl]-2-(phosphonoamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 173217685 |
| Molecular Formula | C12H16NO6P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R)-2-[(4-hydroxyphenyl)methyl]-2-(phosphonoamino)pent-4-enoic acid |
| SMILES | C=CC[C@](Cc1ccc(O)cc1)(NP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C12H16NO6P/c1-2-7-12(11(15)16,13-20(17,18)19)8-9-3-5-10(14)6-4-9/h2-6,14H,1,7-8H2,(H,15,16)(H3,13,17,18,19)/t12-/m1/s1 |
| InChIKey | NACPGCLYZXJQRM-GFCCVEGCSA-N |
| XLogP | 1.02 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|