C24H18Cl2F3N3O3S — CID 173220467
2-[[3-[[(3,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl]-[3-(trifluoromethyl)phenyl]methoxy]acetic acid (PubChem CID 173220467) has the molecular formula C24H18Cl2F3N3O3S and a molecular weight of 556.39 g/mol. Its IUPAC name is 2-[[3-[[(3,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl]-[3-(trifluoromethyl)phenyl]methoxy]acetic acid.
| Compound Name | 2-[[3-[[(3,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl]-[3-(trifluoromethyl)phenyl]methoxy]acetic acid |
|---|---|
| PubChem CID | 173220467 |
| Molecular Formula | C24H18Cl2F3N3O3S |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 2-[[3-[[(3,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl]-[3-(trifluoromethyl)phenyl]methoxy]acetic acid |
| SMILES | O=C(O)COC(c1cccc(C=NNC(=S)Nc2ccc(Cl)c(Cl)c2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18Cl2F3N3O3S/c25-19-8-7-18(11-20(19)26)31-23(36)32-30-12-14-3-1-4-15(9-14)22(35-13-21(33)34)16-5-2-6-17(10-16)24(27,28)29/h1-12,22H,13H2,(H,33,34)(H2,31,32,36) |
| InChIKey | CMRPGOIFHREQAF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|