C34H33N5O — CID 173223055
N-(4-piperazin-1-ylphenyl)-5-(2,2,2-triphenylethyl)-1H-imidazole-2-carboxamide (PubChem CID 173223055) has the molecular formula C34H33N5O and a molecular weight of 527.67 g/mol. Its IUPAC name is N-(4-piperazin-1-ylphenyl)-5-(2,2,2-triphenylethyl)-1H-imidazole-2-carboxamide.
| Compound Name | N-(4-piperazin-1-ylphenyl)-5-(2,2,2-triphenylethyl)-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 173223055 |
| Molecular Formula | C34H33N5O |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-(4-piperazin-1-ylphenyl)-5-(2,2,2-triphenylethyl)-1H-imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)cc1)c1ncc(CC(c2ccccc2)(c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C34H33N5O/c40-33(38-29-16-18-31(19-17-29)39-22-20-35-21-23-39)32-36-25-30(37-32)24-34(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-19,25,35H,20-24H2,(H,36,37)(H,38,40) |
| InChIKey | CVJNTXOKRNLMIN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|