C24H29NaO4 — CID 173226357
sodium;hydride;(E)-5-(3-methyl-4-phenylphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pent-2-enoic acid (PubChem CID 173226357) has the molecular formula C24H29NaO4 and a molecular weight of 404.48 g/mol. Its IUPAC name is sodium;hydride;(E)-5-(3-methyl-4-phenylphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pent-2-enoic acid.
| Compound Name | sodium;hydride;(E)-5-(3-methyl-4-phenylphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 173226357 |
| Molecular Formula | C24H29NaO4 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | sodium;hydride;(E)-5-(3-methyl-4-phenylphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pent-2-enoic acid |
| SMILES | Cc1cc(CC/C=C(\CC(=O)OC(C)(C)C)C(=O)O)ccc1-c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C24H28O4.Na.H/c1-17-15-18(13-14-21(17)19-10-6-5-7-11-19)9-8-12-20(23(26)27)16-22(25)28-24(2,3)4;;/h5-7,10-15H,8-9,16H2,1-4H3,(H,26,27);;/q;+1;-1/b20-12+;; |
| InChIKey | XHQRZLSZXIPPFA-FPIMHUBQSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|