C20H27NO2 — CID 173226507
3-(2-ethylhexoxy)-5-(3-methoxyphenyl)penta-2,4-dienenitrile (PubChem CID 173226507) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)-5-(3-methoxyphenyl)penta-2,4-dienenitrile.
| Compound Name | 3-(2-ethylhexoxy)-5-(3-methoxyphenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173226507 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3-(2-ethylhexoxy)-5-(3-methoxyphenyl)penta-2,4-dienenitrile |
| SMILES | CCCCC(CC)COC(C=Cc1cccc(OC)c1)=CC#N |
| InChI | InChI=1S/C20H27NO2/c1-4-6-8-17(5-2)16-23-19(13-14-21)12-11-18-9-7-10-20(15-18)22-3/h7,9-13,15,17H,4-6,8,16H2,1-3H3 |
| InChIKey | LRLUMGUIRNHBAV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|