C12H15NO — CID 173226716
3-(4-amino-2,3,5-trimethylphenyl)prop-2-enal (PubChem CID 173226716) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(4-amino-2,3,5-trimethylphenyl)prop-2-enal.
| Compound Name | 3-(4-amino-2,3,5-trimethylphenyl)prop-2-enal |
|---|---|
| PubChem CID | 173226716 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(4-amino-2,3,5-trimethylphenyl)prop-2-enal |
| SMILES | Cc1cc(C=CC=O)c(C)c(C)c1N |
| InChI | InChI=1S/C12H15NO/c1-8-7-11(5-4-6-14)9(2)10(3)12(8)13/h4-7H,13H2,1-3H3 |
| InChIKey | MARYRGVMDUFUAQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|