C10H17N2NaO8 — CID 173228651
sodium;3-(carboxymethylamino)-3-[(carboxymethylamino)methyl]pentanedioic acid;hydride (PubChem CID 173228651) has the molecular formula C10H17N2NaO8 and a molecular weight of 316.24 g/mol. Its IUPAC name is sodium;3-(carboxymethylamino)-3-[(carboxymethylamino)methyl]pentanedioic acid;hydride.
| Compound Name | sodium;3-(carboxymethylamino)-3-[(carboxymethylamino)methyl]pentanedioic acid;hydride |
|---|---|
| PubChem CID | 173228651 |
| Molecular Formula | C10H17N2NaO8 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | sodium;3-(carboxymethylamino)-3-[(carboxymethylamino)methyl]pentanedioic acid;hydride |
| SMILES | O=C(O)CNCC(CC(=O)O)(CC(=O)O)NCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H16N2O8.Na.H/c13-6(14)1-10(2-7(15)16,12-4-9(19)20)5-11-3-8(17)18;;/h11-12H,1-5H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+1;-1 |
| InChIKey | POKUMKIOQROTGR-UHFFFAOYSA-N |
| XLogP | -4.86 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |