C33H43Zr- — CID 173230952
3,6-ditert-butyl-2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1,9-dihydrofluoren-1-ide;propan-2-ylidenezirconium (PubChem CID 173230952) has the molecular formula C33H43Zr- and a molecular weight of 530.93 g/mol. Its IUPAC name is 3,6-ditert-butyl-2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1,9-dihydrofluoren-1-ide;propan-2-ylidenezirconium.
| Compound Name | 3,6-ditert-butyl-2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1,9-dihydrofluoren-1-ide;propan-2-ylidenezirconium |
|---|---|
| PubChem CID | 173230952 |
| Molecular Formula | C33H43Zr- |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3,6-ditert-butyl-2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1,9-dihydrofluoren-1-ide;propan-2-ylidenezirconium |
| SMILES | CC(C)(C)C1=CCC(c2[c-]c3c(cc2C(C)(C)C)-c2cc(C(C)(C)C)ccc2C3)=C1.CC(C)=[Zr] |
| InChI | InChI=1S/C30H37.C3H6.Zr/c1-28(2,3)22-12-11-20(15-22)26-16-21-14-19-10-13-23(29(4,5)6)17-24(19)25(21)18-27(26)30(7,8)9;1-3-2;/h10,12-13,15,17-18H,11,14H2,1-9H3;1-2H3;/q-1;; |
| InChIKey | VVZBZYIXKRRMIQ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|