C19H14FNO4 — CID 173231901
4-[2-[(4-fluorophenyl)methyl]-1H-indol-5-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 173231901) has the molecular formula C19H14FNO4 and a molecular weight of 339.32 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methyl]-1H-indol-5-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-[2-[(4-fluorophenyl)methyl]-1H-indol-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 173231901 |
| Molecular Formula | C19H14FNO4 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methyl]-1H-indol-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)C=C(O)c1ccc2[nH]c(Cc3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C19H14FNO4/c20-14-4-1-11(2-5-14)7-15-9-13-8-12(3-6-16(13)21-15)17(22)10-18(23)19(24)25/h1-6,8-10,21-22H,7H2,(H,24,25) |
| InChIKey | FFMNHWZOUGYILV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|