C16H15NO5 — CID 69138438
4-hydroxy-4-[5-[(4-methoxyphenyl)methyl]-1H-pyrrol-3-yl]-2-oxobut-3-enoic acid (PubChem CID 69138438) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 4-hydroxy-4-[5-[(4-methoxyphenyl)methyl]-1H-pyrrol-3-yl]-2-oxobut-3-enoic acid.
| Compound Name | 4-hydroxy-4-[5-[(4-methoxyphenyl)methyl]-1H-pyrrol-3-yl]-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 69138438 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-hydroxy-4-[5-[(4-methoxyphenyl)methyl]-1H-pyrrol-3-yl]-2-oxobut-3-enoic acid |
| SMILES | COc1ccc(Cc2cc(C(O)=CC(=O)C(=O)O)c[nH]2)cc1 |
| InChI | InChI=1S/C16H15NO5/c1-22-13-4-2-10(3-5-13)6-12-7-11(9-17-12)14(18)8-15(19)16(20)21/h2-5,7-9,17-18H,6H2,1H3,(H,20,21) |
| InChIKey | HVIHRQBKGMEZNW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|