C34H58NO6P — CID 173234720
2-[3,6-dihydroxy-10-(3-hydroxycyclohexyl)-3-[2-(2-methyloctylamino)ethyl]-4-phosphanyloxydeca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 173234720) has the molecular formula C34H58NO6P and a molecular weight of 607.81 g/mol. Its IUPAC name is 2-[3,6-dihydroxy-10-(3-hydroxycyclohexyl)-3-[2-(2-methyloctylamino)ethyl]-4-phosphanyloxydeca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | 2-[3,6-dihydroxy-10-(3-hydroxycyclohexyl)-3-[2-(2-methyloctylamino)ethyl]-4-phosphanyloxydeca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 173234720 |
| Molecular Formula | C34H58NO6P |
| Molecular Weight | 607.81 g/mol |
| Exact Mass | 607.40 |
| IUPAC Name | 2-[3,6-dihydroxy-10-(3-hydroxycyclohexyl)-3-[2-(2-methyloctylamino)ethyl]-4-phosphanyloxydeca-1,7,9-trienyl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCC(C)CNCCC(O)(C=CC1OC(=O)C=CC1CC)C(CC(O)C=CC=CC1CCCC(O)C1)OP |
| InChI | InChI=1S/C34H58NO6P/c1-4-6-7-8-12-26(3)25-35-22-21-34(39,20-19-31-28(5-2)17-18-33(38)40-31)32(41-42)24-30(37)15-10-9-13-27-14-11-16-29(36)23-27/h9-10,13,15,17-20,26-32,35-37,39H,4-8,11-12,14,16,21-25,42H2,1-3H3 |
| InChIKey | KEPHAZVNMBBOPL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.81 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|