C35H63FOSi3 — CID 173235344
triethyl-[[(5-fluoronaphthalen-1-yl)oxy-propan-2-yl-(6-tripropylsilylhexyl)silyl]methyl]silane (PubChem CID 173235344) has the molecular formula C35H63FOSi3 and a molecular weight of 603.14 g/mol. Its IUPAC name is triethyl-[[(5-fluoronaphthalen-1-yl)oxy-propan-2-yl-(6-tripropylsilylhexyl)silyl]methyl]silane.
| Compound Name | triethyl-[[(5-fluoronaphthalen-1-yl)oxy-propan-2-yl-(6-tripropylsilylhexyl)silyl]methyl]silane |
|---|---|
| PubChem CID | 173235344 |
| Molecular Formula | C35H63FOSi3 |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | triethyl-[[(5-fluoronaphthalen-1-yl)oxy-propan-2-yl-(6-tripropylsilylhexyl)silyl]methyl]silane |
| SMILES | CCC[Si](CCC)(CCC)CCCCCC[Si](C[Si](CC)(CC)CC)(Oc1cccc2c(F)cccc12)C(C)C |
| InChI | InChI=1S/C35H63FOSi3/c1-9-25-39(26-10-2,27-11-3)28-17-15-16-18-29-40(31(7)8,30-38(12-4,13-5)14-6)37-35-24-20-21-32-33(35)22-19-23-34(32)36/h19-24,31H,9-18,25-30H2,1-8H3 |
| InChIKey | UFMNHCFIBZYALX-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|