C32H45F9OSi2 — CID 141045117
triethyl-[2-[nonyl-propan-2-yl-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silyl]ethyl]silane (PubChem CID 141045117) has the molecular formula C32H45F9OSi2 and a molecular weight of 672.87 g/mol. Its IUPAC name is triethyl-[2-[nonyl-propan-2-yl-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silyl]ethyl]silane.
| Compound Name | triethyl-[2-[nonyl-propan-2-yl-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silyl]ethyl]silane |
|---|---|
| PubChem CID | 141045117 |
| Molecular Formula | C32H45F9OSi2 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | triethyl-[2-[nonyl-propan-2-yl-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silyl]ethyl]silane |
| SMILES | CCCCCCCCC[Si](CC[Si](CC)(CC)CC)(Oc1c(F)c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c1F)C(C)C |
| InChI | InChI=1S/C32H45F9OSi2/c1-7-11-12-13-14-15-16-17-44(20(5)6,19-18-43(8-2,9-3)10-4)42-32-26(36)22(25(35)29(39)31(32)41)21-23(33)27(37)30(40)28(38)24(21)34/h20H,7-19H2,1-6H3 |
| InChIKey | VOMMMBLNJOVMHD-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|