C25H43F5OSi2 — CID 141045221
triethyl-[2-[octyl-(2,3,4,5,6-pentafluorophenoxy)-propan-2-ylsilyl]ethyl]silane (PubChem CID 141045221) has the molecular formula C25H43F5OSi2 and a molecular weight of 510.78 g/mol. Its IUPAC name is triethyl-[2-[octyl-(2,3,4,5,6-pentafluorophenoxy)-propan-2-ylsilyl]ethyl]silane.
| Compound Name | triethyl-[2-[octyl-(2,3,4,5,6-pentafluorophenoxy)-propan-2-ylsilyl]ethyl]silane |
|---|---|
| PubChem CID | 141045221 |
| Molecular Formula | C25H43F5OSi2 |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | triethyl-[2-[octyl-(2,3,4,5,6-pentafluorophenoxy)-propan-2-ylsilyl]ethyl]silane |
| SMILES | CCCCCCCC[Si](CC[Si](CC)(CC)CC)(Oc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C25H43F5OSi2/c1-7-11-12-13-14-15-16-33(19(5)6,18-17-32(8-2,9-3)10-4)31-25-23(29)21(27)20(26)22(28)24(25)30/h19H,7-18H2,1-6H3 |
| InChIKey | KTYYQQKXCBPBDY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|