C24H42F4OSi2 — CID 173235628
triethyl-[3-[hexyl-propan-2-yl-(2,3,5,6-tetrafluorophenoxy)silyl]propyl]silane (PubChem CID 173235628) has the molecular formula C24H42F4OSi2 and a molecular weight of 478.76 g/mol. Its IUPAC name is triethyl-[3-[hexyl-propan-2-yl-(2,3,5,6-tetrafluorophenoxy)silyl]propyl]silane.
| Compound Name | triethyl-[3-[hexyl-propan-2-yl-(2,3,5,6-tetrafluorophenoxy)silyl]propyl]silane |
|---|---|
| PubChem CID | 173235628 |
| Molecular Formula | C24H42F4OSi2 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | triethyl-[3-[hexyl-propan-2-yl-(2,3,5,6-tetrafluorophenoxy)silyl]propyl]silane |
| SMILES | CCCCCC[Si](CCC[Si](CC)(CC)CC)(Oc1c(F)c(F)cc(F)c1F)C(C)C |
| InChI | InChI=1S/C24H42F4OSi2/c1-7-11-12-13-16-31(19(5)6,17-14-15-30(8-2,9-3)10-4)29-24-22(27)20(25)18-21(26)23(24)28/h18-19H,7-17H2,1-6H3 |
| InChIKey | OBJYENMDMZRAMT-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|