C34H42F8OSi — CID 173235715
cyclohexyl-(3-ethylnonyl)-(1,3,4,5,6,7,9,10-octafluoroanthracen-2-yl)oxy-propan-2-ylsilane (PubChem CID 173235715) has the molecular formula C34H42F8OSi and a molecular weight of 646.78 g/mol. Its IUPAC name is cyclohexyl-(3-ethylnonyl)-(1,3,4,5,6,7,9,10-octafluoroanthracen-2-yl)oxy-propan-2-ylsilane.
| Compound Name | cyclohexyl-(3-ethylnonyl)-(1,3,4,5,6,7,9,10-octafluoroanthracen-2-yl)oxy-propan-2-ylsilane |
|---|---|
| PubChem CID | 173235715 |
| Molecular Formula | C34H42F8OSi |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | cyclohexyl-(3-ethylnonyl)-(1,3,4,5,6,7,9,10-octafluoroanthracen-2-yl)oxy-propan-2-ylsilane |
| SMILES | CCCCCCC(CC)CC[Si](Oc1c(F)c(F)c2c(F)c3c(F)c(F)c(F)cc3c(F)c2c1F)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C34H42F8OSi/c1-5-7-8-10-13-20(6-2)16-17-44(19(3)4,21-14-11-9-12-15-21)43-34-32(41)25-26(31(40)33(34)42)29(38)24-22(27(25)36)18-23(35)28(37)30(24)39/h18-21H,5-17H2,1-4H3 |
| InChIKey | OXYUAPFJLSFEOL-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|