C30H38F8OSi2 — CID 173235630
cyclohexyl-(1,2,4,5,6,8,9,9-octafluorofluoren-3-yl)oxy-propan-2-yl-(2-triethylsilylethyl)silane (PubChem CID 173235630) has the molecular formula C30H38F8OSi2 and a molecular weight of 622.79 g/mol. Its IUPAC name is cyclohexyl-(1,2,4,5,6,8,9,9-octafluorofluoren-3-yl)oxy-propan-2-yl-(2-triethylsilylethyl)silane.
| Compound Name | cyclohexyl-(1,2,4,5,6,8,9,9-octafluorofluoren-3-yl)oxy-propan-2-yl-(2-triethylsilylethyl)silane |
|---|---|
| PubChem CID | 173235630 |
| Molecular Formula | C30H38F8OSi2 |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | cyclohexyl-(1,2,4,5,6,8,9,9-octafluorofluoren-3-yl)oxy-propan-2-yl-(2-triethylsilylethyl)silane |
| SMILES | CC[Si](CC)(CC)CC[Si](Oc1c(F)c(F)c2c(c1F)-c1c(F)c(F)cc(F)c1C2(F)F)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C30H38F8OSi2/c1-6-40(7-2,8-3)14-15-41(17(4)5,18-12-10-9-11-13-18)39-29-26(34)22-21-23(19(31)16-20(32)25(21)33)30(37,38)24(22)27(35)28(29)36/h16-18H,6-15H2,1-5H3 |
| InChIKey | BIFNWUGBFQYPIX-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|