C41H70F6OSi3 — CID 173235457
cyclohexyl-bis[8-[diethyl(methyl)silyl]octyl]-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]silane (PubChem CID 173235457) has the molecular formula C41H70F6OSi3 and a molecular weight of 777.26 g/mol. Its IUPAC name is cyclohexyl-bis[8-[diethyl(methyl)silyl]octyl]-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]silane.
| Compound Name | cyclohexyl-bis[8-[diethyl(methyl)silyl]octyl]-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]silane |
|---|---|
| PubChem CID | 173235457 |
| Molecular Formula | C41H70F6OSi3 |
| Molecular Weight | 777.26 g/mol |
| Exact Mass | 776.46 |
| IUPAC Name | cyclohexyl-bis[8-[diethyl(methyl)silyl]octyl]-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]silane |
| SMILES | CC[Si](C)(CC)CCCCCCCC[Si](CCCCCCCC[Si](C)(CC)CC)(Oc1c(F)c(F)c2c(c1F)C(F)=C(F)C2F)C1CCCCC1 |
| InChI | InChI=1S/C41H70F6OSi3/c1-7-49(5,8-2)28-22-15-11-13-17-24-30-51(32-26-20-19-21-27-32,31-25-18-14-12-16-23-29-50(6,9-3)10-4)48-41-38(45)34-33(37(44)40(41)47)35(42)39(46)36(34)43/h32,35H,7-31H2,1-6H3 |
| InChIKey | FAIOJPCHAWUESP-UHFFFAOYSA-N |
| XLogP | 16.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.26 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|