C19H22F6OSi — CID 173235319
(1,3,4,6,7,8-hexafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane (PubChem CID 173235319) has the molecular formula C19H22F6OSi and a molecular weight of 408.46 g/mol. Its IUPAC name is (1,3,4,6,7,8-hexafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane.
| Compound Name | (1,3,4,6,7,8-hexafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 173235319 |
| Molecular Formula | C19H22F6OSi |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (1,3,4,6,7,8-hexafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](Oc1c(F)c(F)c2cc(F)c(F)c(F)c2c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H22F6OSi/c1-8(2)27(9(3)4,10(5)6)26-19-17(24)13-11(14(21)18(19)25)7-12(20)15(22)16(13)23/h7-10H,1-6H3 |
| InChIKey | YQQGIGLCQFQARQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|