C48H69F6N3O3Si3 — CID 177453347
[4-[4,6-bis[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-1,3,5-triazin-2-yl]-2,5-difluorophenoxy]-tri(propan-2-yl)silane (PubChem CID 177453347) has the molecular formula C48H69F6N3O3Si3 and a molecular weight of 934.34 g/mol. Its IUPAC name is [4-[4,6-bis[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-1,3,5-triazin-2-yl]-2,5-difluorophenoxy]-tri(propan-2-yl)silane.
| Compound Name | [4-[4,6-bis[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-1,3,5-triazin-2-yl]-2,5-difluorophenoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 177453347 |
| Molecular Formula | C48H69F6N3O3Si3 |
| Molecular Weight | 934.34 g/mol |
| Exact Mass | 933.46 |
| IUPAC Name | [4-[4,6-bis[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-1,3,5-triazin-2-yl]-2,5-difluorophenoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](Oc1cc(F)c(-c2nc(-c3cc(F)c(O[Si](C(C)C)(C(C)C)C(C)C)cc3F)nc(-c3cc(F)c(O[Si](C(C)C)(C(C)C)C(C)C)cc3F)n2)cc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H69F6N3O3Si3/c1-25(2)61(26(3)4,27(5)6)58-43-22-37(49)34(19-40(43)52)46-55-47(35-20-41(53)44(23-38(35)50)59-62(28(7)8,29(9)10)30(11)12)57-48(56-46)36-21-42(54)45(24-39(36)51)60-63(31(13)14,32(15)16)33(17)18/h19-33H,1-18H3 |
| InChIKey | LXVWTZQIAIWENC-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.34 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|