C21H34FNOSi — CID 175729413
1-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]-N,N-dimethylbut-3-yn-2-amine (PubChem CID 175729413) has the molecular formula C21H34FNOSi and a molecular weight of 363.59 g/mol. Its IUPAC name is 1-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]-N,N-dimethylbut-3-yn-2-amine.
| Compound Name | 1-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]-N,N-dimethylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 175729413 |
| Molecular Formula | C21H34FNOSi |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]-N,N-dimethylbut-3-yn-2-amine |
| SMILES | C#CC(Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)c(F)c1)N(C)C |
| InChI | InChI=1S/C21H34FNOSi/c1-10-19(23(8)9)13-18-11-12-21(20(22)14-18)24-25(15(2)3,16(4)5)17(6)7/h1,11-12,14-17,19H,13H2,2-9H3 |
| InChIKey | HJWMONMMYIYGGP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|